methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate

C8H12O3 — CID 131844999

IUPACmethyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate
SMILESCOC(=O)C[C@H]1C=CCCO1
InChIInChI=1S/C8H12O3/c1-10-8(9)6-7-4-2-3-5-11-7/h2,4,7H,3,5-6H2,1H3/t7-/m1/s1
InChIKeyJPMRPWWPUHXLRT-SSDOTTSWSA-N
MW156.18 g/mol
LogP0.89
Rot. Bonds2

About methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate

methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 131844999) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate
PubChem CID131844999
Molecular FormulaC8H12O3
Molecular Weight156.18 g/mol
Exact Mass156.08
IUPAC Namemethyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate
SMILESCOC(=O)C[C@H]1C=CCCO1
InChIInChI=1S/C8H12O3/c1-10-8(9)6-7-4-2-3-5-11-7/h2,4,7H,3,5-6H2,1H3/t7-/m1/s1
InChIKeyJPMRPWWPUHXLRT-SSDOTTSWSA-N
XLogP0.89
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.18
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate?
The IUPAC name of methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate (CID 131844999) is methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate.
What is the SMILES notation for methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate?
The canonical SMILES for methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate is COC(=O)C[C@H]1C=CCCO1.
What is the InChIKey of methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate?
The InChIKey is JPMRPWWPUHXLRT-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12O3/c1-10-8(9)6-7-4-2-3-5-11-7/h2,4,7H,3,5-6H2,1H3/t7-/m1/s1.
What are the key properties of methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate?
methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate has a molecular weight of 156.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate is sourced from PubChem (CID 131844999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).