C8H12O3 — CID 131844999
methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 131844999) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 131844999 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methyl 2-[(6S)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=CCCO1 |
| InChI | InChI=1S/C8H12O3/c1-10-8(9)6-7-4-2-3-5-11-7/h2,4,7H,3,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | JPMRPWWPUHXLRT-SSDOTTSWSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|