C12H19NO5 — CID 54639361
methyl 2-[(2S,3R,6S)-2-(hydroxymethyl)-3-(propanoylamino)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 54639361) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 2-[(2S,3R,6S)-2-(hydroxymethyl)-3-(propanoylamino)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,6S)-2-(hydroxymethyl)-3-(propanoylamino)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 54639361 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | methyl 2-[(2S,3R,6S)-2-(hydroxymethyl)-3-(propanoylamino)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | CCC(=O)N[C@@H]1C=C[C@H](CC(=O)OC)O[C@@H]1CO |
| InChI | InChI=1S/C12H19NO5/c1-3-11(15)13-9-5-4-8(6-12(16)17-2)18-10(9)7-14/h4-5,8-10,14H,3,6-7H2,1-2H3,(H,13,15)/t8-,9-,10-/m1/s1 |
| InChIKey | FSRWVHNAALREIT-OPRDCNLKSA-N |
| XLogP | -0.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|