C17H28N2O4 — CID 54642389
2-[(2S,3R,6S)-3-acetamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54642389) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2S,3R,6S)-3-acetamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(2S,3R,6S)-3-acetamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54642389 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-[(2S,3R,6S)-3-acetamido-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | CC(=O)N[C@@H]1C=C[C@H](CC(=O)NCC2CCCCC2)O[C@@H]1CO |
| InChI | InChI=1S/C17H28N2O4/c1-12(21)19-15-8-7-14(23-16(15)11-20)9-17(22)18-10-13-5-3-2-4-6-13/h7-8,13-16,20H,2-6,9-11H2,1H3,(H,18,22)(H,19,21)/t14-,15-,16-/m1/s1 |
| InChIKey | YUPASXVMZIVORB-BZUAXINKSA-N |
| XLogP | 0.89 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|