C10H21NS — CID 103714101
1-(2-ethylsulfanylethyl)-3,4-dimethylpyrrolidine (PubChem CID 103714101) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-3,4-dimethylpyrrolidine.
| Compound Name | 1-(2-ethylsulfanylethyl)-3,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 103714101 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-3,4-dimethylpyrrolidine |
| SMILES | CCSCCN1CC(C)C(C)C1 |
| InChI | InChI=1S/C10H21NS/c1-4-12-6-5-11-7-9(2)10(3)8-11/h9-10H,4-8H2,1-3H3 |
| InChIKey | YTYORYFJRXZVTO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|