C27H26BrNO4 — CID 103714200
5-(4-bromo-3-methylphenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (PubChem CID 103714200) has the molecular formula C27H26BrNO4 and a molecular weight of 508.41 g/mol. Its IUPAC name is 5-(4-bromo-3-methylphenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(4-bromo-3-methylphenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 103714200 |
| Molecular Formula | C27H26BrNO4 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 5-(4-bromo-3-methylphenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1cc(CC(CCC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)ccc1Br |
| InChI | InChI=1S/C27H26BrNO4/c1-17-14-18(10-12-25(17)28)15-19(11-13-26(30)31)29-27(32)33-16-24-22-8-4-2-6-20(22)21-7-3-5-9-23(21)24/h2-10,12,14,19,24H,11,13,15-16H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | HHYYQHWLPAJIOW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |