C25H24BrNO4S — CID 102844380
5-(4-bromo-5-methylthiophen-2-yl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (PubChem CID 102844380) has the molecular formula C25H24BrNO4S and a molecular weight of 514.44 g/mol. Its IUPAC name is 5-(4-bromo-5-methylthiophen-2-yl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(4-bromo-5-methylthiophen-2-yl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 102844380 |
| Molecular Formula | C25H24BrNO4S |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 5-(4-bromo-5-methylthiophen-2-yl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1sc(CC(CCC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1Br |
| InChI | InChI=1S/C25H24BrNO4S/c1-15-23(26)13-17(32-15)12-16(10-11-24(28)29)27-25(30)31-14-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-9,13,16,22H,10-12,14H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | DQTVXYBMCJZKKO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |