C22H18BrNO4S — CID 165439459
2-(3-bromo-5-methylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (PubChem CID 165439459) has the molecular formula C22H18BrNO4S and a molecular weight of 472.36 g/mol. Its IUPAC name is 2-(3-bromo-5-methylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-(3-bromo-5-methylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 165439459 |
| Molecular Formula | C22H18BrNO4S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-(3-bromo-5-methylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| SMILES | Cc1cc(Br)c(C(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)s1 |
| InChI | InChI=1S/C22H18BrNO4S/c1-12-10-18(23)20(29-12)19(21(25)26)24-22(27)28-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-10,17,19H,11H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | NBEMVPHJNHCDLO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |