C16H14N2O2 — CID 103716734
N-[(3-cyanophenyl)methyl]-2-hydroxy-2-phenylacetamide (PubChem CID 103716734) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 103716734 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2-hydroxy-2-phenylacetamide |
| SMILES | N#Cc1cccc(CNC(=O)C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H14N2O2/c17-10-12-5-4-6-13(9-12)11-18-16(20)15(19)14-7-2-1-3-8-14/h1-9,15,19H,11H2,(H,18,20) |
| InChIKey | XBUMANKNNIBKCV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |