C12H23NO2S — CID 103721391
2,2-dimethyl-5-(3-methylbutan-2-ylsulfonyl)pentanenitrile (PubChem CID 103721391) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylbutan-2-ylsulfonyl)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(3-methylbutan-2-ylsulfonyl)pentanenitrile |
|---|---|
| PubChem CID | 103721391 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylbutan-2-ylsulfonyl)pentanenitrile |
| SMILES | CC(C)C(C)S(=O)(=O)CCCC(C)(C)C#N |
| InChI | InChI=1S/C12H23NO2S/c1-10(2)11(3)16(14,15)8-6-7-12(4,5)9-13/h10-11H,6-8H2,1-5H3 |
| InChIKey | HBFPVTXPZGZADK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |