C10H19NO3S — CID 65263083
5-(2-methoxyethylsulfonyl)-2,2-dimethylpentanenitrile (PubChem CID 65263083) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfonyl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2-methoxyethylsulfonyl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65263083 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-(2-methoxyethylsulfonyl)-2,2-dimethylpentanenitrile |
| SMILES | COCCS(=O)(=O)CCCC(C)(C)C#N |
| InChI | InChI=1S/C10H19NO3S/c1-10(2,9-11)5-4-7-15(12,13)8-6-14-3/h4-8H2,1-3H3 |
| InChIKey | MVCDVYLSUTVXFT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |