C11H20F5NO — CID 103725355
5-(2,2,3,3,3-pentafluoropropoxy)-N-propylpentan-2-amine (PubChem CID 103725355) has the molecular formula C11H20F5NO and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-(2,2,3,3,3-pentafluoropropoxy)-N-propylpentan-2-amine.
| Compound Name | 5-(2,2,3,3,3-pentafluoropropoxy)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 103725355 |
| Molecular Formula | C11H20F5NO |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-(2,2,3,3,3-pentafluoropropoxy)-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CCCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5NO/c1-3-6-17-9(2)5-4-7-18-8-10(12,13)11(14,15)16/h9,17H,3-8H2,1-2H3 |
| InChIKey | FQEMBZIHHGXHAE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|