C13H24F5NO2 — CID 106810644
2-ethyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propylamino)pentan-1-ol (PubChem CID 106810644) has the molecular formula C13H24F5NO2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-ethyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propylamino)pentan-1-ol.
| Compound Name | 2-ethyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810644 |
| Molecular Formula | C13H24F5NO2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-ethyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H24F5NO2/c1-3-7-19-11(4-2,9-20)6-5-8-21-10-12(14,15)13(16,17)18/h19-20H,3-10H2,1-2H3 |
| InChIKey | QQCDPSCVQYQDIO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|