C14H31NO2 — CID 106810286
2-ethyl-5-[(2-methylpropan-2-yl)oxy]-2-(propylamino)pentan-1-ol (PubChem CID 106810286) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 2-ethyl-5-[(2-methylpropan-2-yl)oxy]-2-(propylamino)pentan-1-ol.
| Compound Name | 2-ethyl-5-[(2-methylpropan-2-yl)oxy]-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810286 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 2-ethyl-5-[(2-methylpropan-2-yl)oxy]-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCOC(C)(C)C |
| InChI | InChI=1S/C14H31NO2/c1-6-10-15-14(7-2,12-16)9-8-11-17-13(3,4)5/h15-16H,6-12H2,1-5H3 |
| InChIKey | WXZKDIGOQDBMPN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|