C15H33NO2 — CID 106810300
2-ethyl-5-(2-methylbutan-2-yloxy)-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 106810300) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 2-ethyl-5-(2-methylbutan-2-yloxy)-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 2-ethyl-5-(2-methylbutan-2-yloxy)-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810300 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 2-ethyl-5-(2-methylbutan-2-yloxy)-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCC(CO)(CCCOC(C)(C)CC)NC(C)C |
| InChI | InChI=1S/C15H33NO2/c1-7-14(5,6)18-11-9-10-15(8-2,12-17)16-13(3)4/h13,16-17H,7-12H2,1-6H3 |
| InChIKey | QHRSOAUIHLMBFP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|