C14H32N2O2 — CID 106809549
2-ethyl-5-[2-methoxyethyl(methyl)amino]-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 106809549) has the molecular formula C14H32N2O2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-ethyl-5-[2-methoxyethyl(methyl)amino]-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 2-ethyl-5-[2-methoxyethyl(methyl)amino]-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106809549 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 2-ethyl-5-[2-methoxyethyl(methyl)amino]-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CCC(CO)(CCCN(C)CCOC)NC(C)C |
| InChI | InChI=1S/C14H32N2O2/c1-6-14(12-17,15-13(2)3)8-7-9-16(4)10-11-18-5/h13,15,17H,6-12H2,1-5H3 |
| InChIKey | AHGDUJHTIWIZCJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |