C10H14F3N3O — CID 103725462
N-(2-pyrrol-1-ylethyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 103725462) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is N-(2-pyrrol-1-ylethyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(2-pyrrol-1-ylethyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 103725462 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(2-pyrrol-1-ylethyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)NCCn1cccc1 |
| InChI | InChI=1S/C10H14F3N3O/c11-10(12,13)8-14-7-9(17)15-3-6-16-4-1-2-5-16/h1-2,4-5,14H,3,6-8H2,(H,15,17) |
| InChIKey | NFSNYTRUJQYHAU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |