C13H13N5O2 — CID 103725950
2-(4-cyanophenoxy)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 103725950) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103725950 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)COc1ccc(C#N)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H13N5O2/c1-9(13-15-8-16-18-13)17-12(19)7-20-11-4-2-10(6-14)3-5-11/h2-5,8-9H,7H2,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | JZSSERHKMVNGNM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |