C14H23N5 — CID 103729169
3-methyl-N-octan-4-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 103729169) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-methyl-N-octan-4-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | 3-methyl-N-octan-4-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 103729169 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-methyl-N-octan-4-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | CCCCC(CCC)Nc1nccn2c(C)nnc12 |
| InChI | InChI=1S/C14H23N5/c1-4-6-8-12(7-5-2)16-13-14-18-17-11(3)19(14)10-9-15-13/h9-10,12H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | SJCVRKAUNCHCLR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |