C10H13N5 — CID 115692073
N-but-3-en-2-yl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 115692073) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-but-3-en-2-yl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-but-3-en-2-yl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 115692073 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-but-3-en-2-yl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | C=CC(C)Nc1nccn2c(C)nnc12 |
| InChI | InChI=1S/C10H13N5/c1-4-7(2)12-9-10-14-13-8(3)15(10)6-5-11-9/h4-7H,1H2,2-3H3,(H,11,12) |
| InChIKey | KRRDCYMOJODABO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|