C9H16N2O2S — CID 103729979
3-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]propane-1,2-diol (PubChem CID 103729979) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 103729979 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[2-(1-methylpyrazol-4-yl)ethylsulfanyl]propane-1,2-diol |
| SMILES | Cn1cc(CCSCC(O)CO)cn1 |
| InChI | InChI=1S/C9H16N2O2S/c1-11-5-8(4-10-11)2-3-14-7-9(13)6-12/h4-5,9,12-13H,2-3,6-7H2,1H3 |
| InChIKey | PLOMUILBTAKLEU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|