C11H15F3N2O3S — CID 103730658
7a-methyl-5-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 103730658) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is 7a-methyl-5-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-5-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 103730658 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 7a-methyl-5-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)NCC(O)C(F)(F)F)CS2 |
| InChI | InChI=1S/C11H15F3N2O3S/c1-10-3-2-8(18)16(10)6(5-20-10)9(19)15-4-7(17)11(12,13)14/h6-7,17H,2-5H2,1H3,(H,15,19) |
| InChIKey | YZIGHYXMNASWAT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |