C11H16F2N2O3S — CID 104858111
N-(2,2-difluoro-3-hydroxypropyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 104858111) has the molecular formula C11H16F2N2O3S and a molecular weight of 294.32 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 104858111 |
| Molecular Formula | C11H16F2N2O3S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)NCC(F)(F)CO)CS2 |
| InChI | InChI=1S/C11H16F2N2O3S/c1-10-3-2-8(17)15(10)7(4-19-10)9(18)14-5-11(12,13)6-16/h7,16H,2-6H2,1H3,(H,14,18) |
| InChIKey | KEAOTJPOQVZQOV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |