C14H16F3NO3 — CID 103730683
(E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide (PubChem CID 103730683) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 103730683 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)NCC(O)C(F)(F)F)o1 |
| InChI | InChI=1S/C14H16F3NO3/c1-8-6-10(8)11-4-2-9(21-11)3-5-13(20)18-7-12(19)14(15,16)17/h2-5,8,10,12,19H,6-7H2,1H3,(H,18,20)/b5-3+ |
| InChIKey | YDKSAHOMTSSVMN-HWKANZROSA-N |
| XLogP | 2.46 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|