C8H11F2NOS — CID 103731415
1,1-difluoro-3-(thiophen-3-ylmethylamino)propan-2-ol (PubChem CID 103731415) has the molecular formula C8H11F2NOS and a molecular weight of 207.25 g/mol. Its IUPAC name is 1,1-difluoro-3-(thiophen-3-ylmethylamino)propan-2-ol.
| Compound Name | 1,1-difluoro-3-(thiophen-3-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 103731415 |
| Molecular Formula | C8H11F2NOS |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1,1-difluoro-3-(thiophen-3-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1ccsc1)C(F)F |
| InChI | InChI=1S/C8H11F2NOS/c9-8(10)7(12)4-11-3-6-1-2-13-5-6/h1-2,5,7-8,11-12H,3-4H2 |
| InChIKey | JSXKTNNLGCQKGK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |