C16H21F2NO2 — CID 103731518
3-[(2-butyl-1-benzofuran-3-yl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103731518) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[(2-butyl-1-benzofuran-3-yl)methylamino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(2-butyl-1-benzofuran-3-yl)methylamino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103731518 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[(2-butyl-1-benzofuran-3-yl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | CCCCc1oc2ccccc2c1CNCC(O)C(F)F |
| InChI | InChI=1S/C16H21F2NO2/c1-2-3-7-15-12(9-19-10-13(20)16(17)18)11-6-4-5-8-14(11)21-15/h4-6,8,13,16,19-20H,2-3,7,9-10H2,1H3 |
| InChIKey | VBAODIROGXLKOM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |