C18H21NOS — CID 63001648
N-[(2-butyl-1-benzofuran-3-yl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 63001648) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is N-[(2-butyl-1-benzofuran-3-yl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(2-butyl-1-benzofuran-3-yl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 63001648 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(2-butyl-1-benzofuran-3-yl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | CCCCc1oc2ccccc2c1CNCc1ccsc1 |
| InChI | InChI=1S/C18H21NOS/c1-2-3-7-18-16(12-19-11-14-9-10-21-13-14)15-6-4-5-8-17(15)20-18/h4-6,8-10,13,19H,2-3,7,11-12H2,1H3 |
| InChIKey | QCBUHNAQOPXDAL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |