C8H6BrF4NOS — CID 103732642
N-[(5-bromothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732642) has the molecular formula C8H6BrF4NOS and a molecular weight of 320.11 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732642 |
| Molecular Formula | C8H6BrF4NOS |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCc1ccc(Br)s1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H6BrF4NOS/c9-5-2-1-4(16-5)3-14-7(15)8(12,13)6(10)11/h1-2,6H,3H2,(H,14,15) |
| InChIKey | WGMHNLUYVILCGH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|