C13H12ClN3O4 — CID 103732716
2-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-nitropyridine-4-carboxamide (PubChem CID 103732716) has the molecular formula C13H12ClN3O4 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103732716 |
| Molecular Formula | C13H12ClN3O4 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-chloro-N-[1-(furan-2-yl)propan-2-yl]-5-nitropyridine-4-carboxamide |
| SMILES | CC(Cc1ccco1)NC(=O)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12ClN3O4/c1-8(5-9-3-2-4-21-9)16-13(18)10-6-12(14)15-7-11(10)17(19)20/h2-4,6-8H,5H2,1H3,(H,16,18) |
| InChIKey | OVTLQRGAABWOLS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|