C12H12F4N2O3 — CID 103732751
2,2,3,3-tetrafluoro-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]propanamide (PubChem CID 103732751) has the molecular formula C12H12F4N2O3 and a molecular weight of 308.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 103732751 |
| Molecular Formula | C12H12F4N2O3 |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[3-[2-(methylamino)-2-oxoethoxy]phenyl]propanamide |
| SMILES | CNC(=O)COc1cccc(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H12F4N2O3/c1-17-9(19)6-21-8-4-2-3-7(5-8)18-11(20)12(15,16)10(13)14/h2-5,10H,6H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | QLDXDJSHCBUJLS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|