C10H18F2N2O2 — CID 103734260
1-cyclohexyl-3-(3,3-difluoro-2-hydroxypropyl)urea (PubChem CID 103734260) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3-difluoro-2-hydroxypropyl)urea.
| Compound Name | 1-cyclohexyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 103734260 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-cyclohexyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
| SMILES | O=C(NCC(O)C(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C10H18F2N2O2/c11-9(12)8(15)6-13-10(16)14-7-4-2-1-3-5-7/h7-9,15H,1-6H2,(H2,13,14,16) |
| InChIKey | DFILLAPMNQGXLR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |