C8H16F2N2O2 — CID 103734261
1-butyl-3-(3,3-difluoro-2-hydroxypropyl)urea (PubChem CID 103734261) has the molecular formula C8H16F2N2O2 and a molecular weight of 210.22 g/mol. Its IUPAC name is 1-butyl-3-(3,3-difluoro-2-hydroxypropyl)urea.
| Compound Name | 1-butyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 103734261 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-butyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
| SMILES | CCCCNC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C8H16F2N2O2/c1-2-3-4-11-8(14)12-5-6(13)7(9)10/h6-7,13H,2-5H2,1H3,(H2,11,12,14) |
| InChIKey | NLIDIMPCCUQXLG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|