C37H49N2O14S4+ — CID 10373448
6-[3-methyl-2-[(1E,3E,5E)-5-[3-methyl-5-sulfo-3-(4-sulfobutyl)-1H-indol-2-ylidene]penta-1,3-dienyl]-5-sulfo-1-(4-sulfobutyl)indol-1-ium-3-yl]hexanoic acid (PubChem CID 10373448) has the molecular formula C37H49N2O14S4+ and a molecular weight of 874.07 g/mol. Its IUPAC name is 6-[3-methyl-2-[(1E,3E,5E)-5-[3-methyl-5-sulfo-3-(4-sulfobutyl)-1H-indol-2-ylidene]penta-1,3-dienyl]-5-sulfo-1-(4-sulfobutyl)indol-1-ium-3-yl]hexanoic acid.
| Compound Name | 6-[3-methyl-2-[(1E,3E,5E)-5-[3-methyl-5-sulfo-3-(4-sulfobutyl)-1H-indol-2-ylidene]penta-1,3-dienyl]-5-sulfo-1-(4-sulfobutyl)indol-1-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 10373448 |
| Molecular Formula | C37H49N2O14S4+ |
| Molecular Weight | 874.07 g/mol |
| Exact Mass | 873.21 |
| IUPAC Name | 6-[3-methyl-2-[(1E,3E,5E)-5-[3-methyl-5-sulfo-3-(4-sulfobutyl)-1H-indol-2-ylidene]penta-1,3-dienyl]-5-sulfo-1-(4-sulfobutyl)indol-1-ium-3-yl]hexanoic acid |
| SMILES | CC1(CCCCCC(=O)O)C(/C=C/C=C/C=C2/Nc3ccc(S(=O)(=O)O)cc3C2(C)CCCCS(=O)(=O)O)=[N+](CCCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C37H48N2O14S4/c1-36(20-9-11-23-54(42,43)44)29-25-27(56(48,49)50)16-18-31(29)38-33(36)13-5-3-6-14-34-37(2,21-8-4-7-15-35(40)41)30-26-28(57(51,52)53)17-19-32(30)39(34)22-10-12-24-55(45,46)47/h3,5-6,13-14,16-19,25-26H,4,7-12,15,20-24H2,1-2H3,(H5,40,41,42,43,44,45,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | NHRAAIROOLGLAD-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 269.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|