C11H21NO6S — CID 103734576
methyl 2-[(2-methoxy-2-oxoethyl)-(2-propan-2-ylsulfonylethyl)amino]acetate (PubChem CID 103734576) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-(2-propan-2-ylsulfonylethyl)amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-(2-propan-2-ylsulfonylethyl)amino]acetate |
|---|---|
| PubChem CID | 103734576 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-(2-propan-2-ylsulfonylethyl)amino]acetate |
| SMILES | COC(=O)CN(CCS(=O)(=O)C(C)C)CC(=O)OC |
| InChI | InChI=1S/C11H21NO6S/c1-9(2)19(15,16)6-5-12(7-10(13)17-3)8-11(14)18-4/h9H,5-8H2,1-4H3 |
| InChIKey | AUHBTBUJWCNRCA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |