C10H20N2O — CID 103734831
2-[(1-ethylcyclopropyl)methylamino]butanamide (PubChem CID 103734831) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(1-ethylcyclopropyl)methylamino]butanamide.
| Compound Name | 2-[(1-ethylcyclopropyl)methylamino]butanamide |
|---|---|
| PubChem CID | 103734831 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-[(1-ethylcyclopropyl)methylamino]butanamide |
| SMILES | CCC(NCC1(CC)CC1)C(N)=O |
| InChI | InChI=1S/C10H20N2O/c1-3-8(9(11)13)12-7-10(4-2)5-6-10/h8,12H,3-7H2,1-2H3,(H2,11,13) |
| InChIKey | GMRPMXIPQHMQBF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |