C11H16ClNO — CID 103735965
1-(5-chlorofuran-2-yl)-N-[(1-methylcyclobutyl)methyl]methanamine (PubChem CID 103735965) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-N-[(1-methylcyclobutyl)methyl]methanamine.
| Compound Name | 1-(5-chlorofuran-2-yl)-N-[(1-methylcyclobutyl)methyl]methanamine |
|---|---|
| PubChem CID | 103735965 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-N-[(1-methylcyclobutyl)methyl]methanamine |
| SMILES | CC1(CNCc2ccc(Cl)o2)CCC1 |
| InChI | InChI=1S/C11H16ClNO/c1-11(5-2-6-11)8-13-7-9-3-4-10(12)14-9/h3-4,13H,2,5-8H2,1H3 |
| InChIKey | UUEJMSFYWJIWRF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |