C14H17N3O — CID 103737418
N-[(1-methylcyclobutyl)methyl]-1H-indazole-3-carboxamide (PubChem CID 103737418) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 103737418 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1H-indazole-3-carboxamide |
| SMILES | CC1(CNC(=O)c2n[nH]c3ccccc23)CCC1 |
| InChI | InChI=1S/C14H17N3O/c1-14(7-4-8-14)9-15-13(18)12-10-5-2-3-6-11(10)16-17-12/h2-3,5-6H,4,7-9H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | ZODBJBHYMWZLLH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |