C19H24N4O2 — CID 87053455
N-[[(4aS,7aR)-1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-1H-indazole-3-carboxamide (PubChem CID 87053455) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[[(4aS,7aR)-1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[[(4aS,7aR)-1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 87053455 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[[(4aS,7aR)-1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-1H-indazole-3-carboxamide |
| SMILES | CCN1C(=O)CC[C@]2(CNC(=O)c3n[nH]c4ccccc34)CCC[C@@H]12 |
| InChI | InChI=1S/C19H24N4O2/c1-2-23-15-8-5-10-19(15,11-9-16(23)24)12-20-18(25)17-13-6-3-4-7-14(13)21-22-17/h3-4,6-7,15H,2,5,8-12H2,1H3,(H,20,25)(H,21,22)/t15-,19+/m1/s1 |
| InChIKey | XIUUSFWITSUJKP-BEFAXECRSA-N |
| XLogP | 2.47 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |