C21H28N4O3 — CID 110143682
N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-1H-indazole-3-carboxamide (PubChem CID 110143682) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 110143682 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[[(2R,3aR,4S,8aR)-1-acetyl-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-2-yl]methyl]-1H-indazole-3-carboxamide |
| SMILES | CC(=O)N1[C@@H](CNC(=O)c2n[nH]c3ccccc23)C[C@@]2(C)[C@@H](O)CCCC[C@@H]12 |
| InChI | InChI=1S/C21H28N4O3/c1-13(26)25-14(11-21(2)17(25)9-5-6-10-18(21)27)12-22-20(28)19-15-7-3-4-8-16(15)23-24-19/h3-4,7-8,14,17-18,27H,5-6,9-12H2,1-2H3,(H,22,28)(H,23,24)/t14-,17-,18+,21-/m1/s1 |
| InChIKey | FKHOCUXXQJLQJO-WMIGDMCZSA-N |
| XLogP | 2.22 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |