C9H19NO4S — CID 103738839
(3S,4R)-1-(2-propan-2-ylsulfonylethyl)pyrrolidine-3,4-diol (PubChem CID 103738839) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is (3S,4R)-1-(2-propan-2-ylsulfonylethyl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(2-propan-2-ylsulfonylethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 103738839 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3S,4R)-1-(2-propan-2-ylsulfonylethyl)pyrrolidine-3,4-diol |
| SMILES | CC(C)S(=O)(=O)CCN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C9H19NO4S/c1-7(2)15(13,14)4-3-10-5-8(11)9(12)6-10/h7-9,11-12H,3-6H2,1-2H3/t8-,9+ |
| InChIKey | YPEOIZZQEAYAFZ-DTORHVGOSA-N |
| XLogP | -1.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |