C11H8Br2N2OS — CID 103738893
2,5-dibromo-N-(5-methyl-3-pyridinyl)thiophene-3-carboxamide (PubChem CID 103738893) has the molecular formula C11H8Br2N2OS and a molecular weight of 376.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(5-methyl-3-pyridinyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(5-methyl-3-pyridinyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103738893 |
| Molecular Formula | C11H8Br2N2OS |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | 2,5-dibromo-N-(5-methyl-3-pyridinyl)thiophene-3-carboxamide |
| SMILES | Cc1cncc(NC(=O)c2cc(Br)sc2Br)c1 |
| InChI | InChI=1S/C11H8Br2N2OS/c1-6-2-7(5-14-4-6)15-11(16)8-3-9(12)17-10(8)13/h2-5H,1H3,(H,15,16) |
| InChIKey | CGNLCRZVDAKQFZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |