C44H30Br8CuN8+6 — CID 10374259
copper 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin (PubChem CID 10374259) has the molecular formula C44H30Br8CuN8+6 and a molecular weight of 1373.56 g/mol. Its IUPAC name is copper 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin.
| Compound Name | copper 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10374259 |
| Molecular Formula | C44H30Br8CuN8+6 |
| Molecular Weight | 1373.56 g/mol |
| Exact Mass | 1364.53 |
| IUPAC Name | copper 2,3,7,8,12,13,17,18-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4[nH]c(c(Br)c4Br)c(-c4cc[n+](C)cc4)c4[nH]c(c(Br)c4Br)c(-c4cc[n+](C)cc4)c4nc2C(Br)=C4Br)C(Br)=C3Br)cc1.[Cu+2] |
| InChI | InChI=1S/C44H29Br8N8.Cu/c1-57-13-5-21(6-14-57)25-37-29(45)31(47)39(53-37)26(22-7-15-58(2)16-8-22)41-33(49)35(51)43(55-41)28(24-11-19-60(4)20-12-24)44-36(52)34(50)42(56-44)27(23-9-17-59(3)18-10-23)40-32(48)30(46)38(25)54-40;/h5-20H,1-4H3,(H,53,54,55,56);/q+3;+2/p+1/b37-25-,38-25-,39-26-,40-27-,41-26-,42-27-,43-28-,44-28-; |
| InChIKey | GGOVPQRKBZESKT-OEHKZIGDSA-O |
| XLogP | 12.56 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1373.56 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|