C13H19N3O3 — CID 103742736
N-(3-methoxy-2,2-dimethylcyclobutyl)-5-methyl-3-nitropyridin-2-amine (PubChem CID 103742736) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(3-methoxy-2,2-dimethylcyclobutyl)-5-methyl-3-nitropyridin-2-amine.
| Compound Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-5-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 103742736 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-5-methyl-3-nitropyridin-2-amine |
| SMILES | COC1CC(Nc2ncc(C)cc2[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C13H19N3O3/c1-8-5-9(16(17)18)12(14-7-8)15-10-6-11(19-4)13(10,2)3/h5,7,10-11H,6H2,1-4H3,(H,14,15) |
| InChIKey | UDUFGGDGBXHCPO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|