C14H20N2O3 — CID 103742777
N-(3-methoxy-2,2-dimethylcyclobutyl)-2-methyl-4-nitroaniline (PubChem CID 103742777) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(3-methoxy-2,2-dimethylcyclobutyl)-2-methyl-4-nitroaniline.
| Compound Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 103742777 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(3-methoxy-2,2-dimethylcyclobutyl)-2-methyl-4-nitroaniline |
| SMILES | COC1CC(Nc2ccc([N+](=O)[O-])cc2C)C1(C)C |
| InChI | InChI=1S/C14H20N2O3/c1-9-7-10(16(17)18)5-6-11(9)15-12-8-13(19-4)14(12,2)3/h5-7,12-13,15H,8H2,1-4H3 |
| InChIKey | HVDSUBPTJLLXRN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|