C6H10N4O2 — CID 103743952
1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea (PubChem CID 103743952) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea.
| Compound Name | 1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 103743952 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-methyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
| SMILES | CNC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C6H10N4O2/c1-7-6(11)8-3-2-5-9-4-10-12-5/h4H,2-3H2,1H3,(H2,7,8,11) |
| InChIKey | ISSHQCKHJQUZLK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |