C7H9N3O4 — CID 104889379
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid (PubChem CID 104889379) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid.
| Compound Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 104889379 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C7H9N3O4/c11-5(3-7(12)13)8-2-1-6-9-4-10-14-6/h4H,1-3H2,(H,8,11)(H,12,13) |
| InChIKey | YCGXNZURYARQQB-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|