3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid

C7H9N3O4 — CID 104889379

IUPAC3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid
SMILESO=C(O)CC(=O)NCCc1ncno1
InChIInChI=1S/C7H9N3O4/c11-5(3-7(12)13)8-2-1-6-9-4-10-14-6/h4H,1-3H2,(H,8,11)(H,12,13)
InChIKeyYCGXNZURYARQQB-UHFFFAOYSA-N
MW199.17 g/mol
LogP-0.80
Rot. Bonds5

About 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid

3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid (PubChem CID 104889379) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid.

Molecular Properties

Compound Name3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid
PubChem CID104889379
Molecular FormulaC7H9N3O4
Molecular Weight199.17 g/mol
Exact Mass199.06
IUPAC Name3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid
SMILESO=C(O)CC(=O)NCCc1ncno1
InChIInChI=1S/C7H9N3O4/c11-5(3-7(12)13)8-2-1-6-9-4-10-14-6/h4H,1-3H2,(H,8,11)(H,12,13)
InChIKeyYCGXNZURYARQQB-UHFFFAOYSA-N
XLogP-0.80
TPSA105.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.17
LogP ≤ 5-0.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid?
The IUPAC name of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid (CID 104889379) is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid.
What is the SMILES notation for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid?
The canonical SMILES for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid is O=C(O)CC(=O)NCCc1ncno1.
What is the InChIKey of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid?
The InChIKey is YCGXNZURYARQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c11-5(3-7(12)13)8-2-1-6-9-4-10-14-6/h4H,1-3H2,(H,8,11)(H,12,13).
What are the key properties of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid?
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid has a molecular weight of 199.17 g/mol, XLogP of -0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-3-oxopropanoic acid is sourced from PubChem (CID 104889379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).