C9H17N5O — CID 103743964
2-(2-methylpropyl)-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 103743964) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 2-(2-methylpropyl)-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 103743964 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(2-methylpropyl)-1-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CC(C)C/N=C(\N)NCCc1ncno1 |
| InChI | InChI=1S/C9H17N5O/c1-7(2)5-12-9(10)11-4-3-8-13-6-14-15-8/h6-7H,3-5H2,1-2H3,(H3,10,11,12) |
| InChIKey | ZNPQPXCUSLGDDY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|