C7H13N5O — CID 103743970
1-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 103743970) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 1-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 103743970 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(N)=N/CCc1ncno1 |
| InChI | InChI=1S/C7H13N5O/c1-2-9-7(8)10-4-3-6-11-5-12-13-6/h5H,2-4H2,1H3,(H3,8,9,10) |
| InChIKey | ADEZXTZTNFGNOM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|