C10H15N5OS — CID 103744176
3-(3-ethylsulfanylpropyl)-7-methylpyrazolo[5,4-d]triazin-4-one (PubChem CID 103744176) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 3-(3-ethylsulfanylpropyl)-7-methylpyrazolo[5,4-d]triazin-4-one.
| Compound Name | 3-(3-ethylsulfanylpropyl)-7-methylpyrazolo[5,4-d]triazin-4-one |
|---|---|
| PubChem CID | 103744176 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(3-ethylsulfanylpropyl)-7-methylpyrazolo[5,4-d]triazin-4-one |
| SMILES | CCSCCCn1nnc2c(cnn2C)c1=O |
| InChI | InChI=1S/C10H15N5OS/c1-3-17-6-4-5-15-10(16)8-7-11-14(2)9(8)12-13-15/h7H,3-6H2,1-2H3 |
| InChIKey | DJDYTBYTYBRWMZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|