C17H19N5O3 — CID 100634454
3-[2-(4-butoxyphenyl)-2-oxoethyl]-7-methylpyrazolo[5,4-d]triazin-4-one (PubChem CID 100634454) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[2-(4-butoxyphenyl)-2-oxoethyl]-7-methylpyrazolo[5,4-d]triazin-4-one.
| Compound Name | 3-[2-(4-butoxyphenyl)-2-oxoethyl]-7-methylpyrazolo[5,4-d]triazin-4-one |
|---|---|
| PubChem CID | 100634454 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-[2-(4-butoxyphenyl)-2-oxoethyl]-7-methylpyrazolo[5,4-d]triazin-4-one |
| SMILES | CCCCOc1ccc(C(=O)Cn2nnc3c(cnn3C)c2=O)cc1 |
| InChI | InChI=1S/C17H19N5O3/c1-3-4-9-25-13-7-5-12(6-8-13)15(23)11-22-17(24)14-10-18-21(2)16(14)19-20-22/h5-8,10H,3-4,9,11H2,1-2H3 |
| InChIKey | FQNHEHQOMVNLKF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|