C25H29N3O5 — CID 123583418
2-[2-(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-4-oxo-4-(4-pentoxyphenyl)butanoic acid (PubChem CID 123583418) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[2-(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-4-oxo-4-(4-pentoxyphenyl)butanoic acid.
| Compound Name | 2-[2-(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-4-oxo-4-(4-pentoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 123583418 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[2-(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-4-oxo-4-(4-pentoxyphenyl)butanoic acid |
| SMILES | CCCCCOc1ccc(C(=O)CC(CCn2nnc3cc(C)ccc3c2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-3-4-5-14-33-20-9-7-18(8-10-20)23(29)16-19(25(31)32)12-13-28-24(30)21-11-6-17(2)15-22(21)26-27-28/h6-11,15,19H,3-5,12-14,16H2,1-2H3,(H,31,32) |
| InChIKey | MVNIZWSCCXEHFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|